C15H20ClN3 — CID 171314768
(R)-piperidin-4-yl(quinolin-4-yl)methanamine;hydrochloride (PubChem CID 171314768) has the molecular formula C15H20ClN3 and a molecular weight of 277.80 g/mol. Its IUPAC name is (R)-piperidin-4-yl(quinolin-4-yl)methanamine;hydrochloride.
| Compound Name | (R)-piperidin-4-yl(quinolin-4-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171314768 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (R)-piperidin-4-yl(quinolin-4-yl)methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccnc2ccccc12)C1CCNCC1 |
| InChI | InChI=1S/C15H19N3.ClH/c16-15(11-5-8-17-9-6-11)13-7-10-18-14-4-2-1-3-12(13)14;/h1-4,7,10-11,15,17H,5-6,8-9,16H2;1H/t15-;/m1./s1 |
| InChIKey | DJFCUIJMHUNCFH-XFULWGLBSA-N |
| XLogP | 2.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |