C13H20NO2+ — CID 7046984
[(1S)-1-(2,4-dimethylphenyl)-3-ethoxy-3-oxopropyl]azanium (PubChem CID 7046984) has the molecular formula C13H20NO2+ and a molecular weight of 222.31 g/mol. Its IUPAC name is [(1S)-1-(2,4-dimethylphenyl)-3-ethoxy-3-oxopropyl]azanium.
| Compound Name | [(1S)-1-(2,4-dimethylphenyl)-3-ethoxy-3-oxopropyl]azanium |
|---|---|
| PubChem CID | 7046984 |
| Molecular Formula | C13H20NO2+ |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | [(1S)-1-(2,4-dimethylphenyl)-3-ethoxy-3-oxopropyl]azanium |
| SMILES | CCOC(=O)C[C@H]([NH3+])c1ccc(C)cc1C |
| InChI | InChI=1S/C13H19NO2/c1-4-16-13(15)8-12(14)11-6-5-9(2)7-10(11)3/h5-7,12H,4,8,14H2,1-3H3/p+1/t12-/m0/s1 |
| InChIKey | MNNXEQNSELIMTJ-LBPRGKRZSA-O |
| XLogP | 1.54 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |