C14H17FN2O — CID 82139134
3-cyano-N,N-diethyl-3-(3-fluorophenyl)propanamide (PubChem CID 82139134) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is 3-cyano-N,N-diethyl-3-(3-fluorophenyl)propanamide.
| Compound Name | 3-cyano-N,N-diethyl-3-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 82139134 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-cyano-N,N-diethyl-3-(3-fluorophenyl)propanamide |
| SMILES | CCN(CC)C(=O)CC(C#N)c1cccc(F)c1 |
| InChI | InChI=1S/C14H17FN2O/c1-3-17(4-2)14(18)9-12(10-16)11-6-5-7-13(15)8-11/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | JPFVSPAJJVVEKH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |