C12H12FNO — CID 43157077
2-(3-fluorophenyl)-3-oxohexanenitrile (PubChem CID 43157077) has the molecular formula C12H12FNO and a molecular weight of 205.23 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-3-oxohexanenitrile.
| Compound Name | 2-(3-fluorophenyl)-3-oxohexanenitrile |
|---|---|
| PubChem CID | 43157077 |
| Molecular Formula | C12H12FNO |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-(3-fluorophenyl)-3-oxohexanenitrile |
| SMILES | CCCC(=O)C(C#N)c1cccc(F)c1 |
| InChI | InChI=1S/C12H12FNO/c1-2-4-12(15)11(8-14)9-5-3-6-10(13)7-9/h3,5-7,11H,2,4H2,1H3 |
| InChIKey | LRRCJIIYKJUJPE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |