C18H16FNO — CID 43334507
2-(3-fluorophenyl)-3-oxo-6-phenylhexanenitrile (PubChem CID 43334507) has the molecular formula C18H16FNO and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-3-oxo-6-phenylhexanenitrile.
| Compound Name | 2-(3-fluorophenyl)-3-oxo-6-phenylhexanenitrile |
|---|---|
| PubChem CID | 43334507 |
| Molecular Formula | C18H16FNO |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(3-fluorophenyl)-3-oxo-6-phenylhexanenitrile |
| SMILES | N#CC(C(=O)CCCc1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H16FNO/c19-16-10-5-9-15(12-16)17(13-20)18(21)11-4-8-14-6-2-1-3-7-14/h1-3,5-7,9-10,12,17H,4,8,11H2 |
| InChIKey | NKECXSOFCJKFDH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |