C22H20FNO2 — CID 56528308
[(3-fluorophenyl)-pyridin-2-ylmethyl] 4-phenylbutanoate (PubChem CID 56528308) has the molecular formula C22H20FNO2 and a molecular weight of 349.41 g/mol. Its IUPAC name is [(3-fluorophenyl)-pyridin-2-ylmethyl] 4-phenylbutanoate.
| Compound Name | [(3-fluorophenyl)-pyridin-2-ylmethyl] 4-phenylbutanoate |
|---|---|
| PubChem CID | 56528308 |
| Molecular Formula | C22H20FNO2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(3-fluorophenyl)-pyridin-2-ylmethyl] 4-phenylbutanoate |
| SMILES | O=C(CCCc1ccccc1)OC(c1cccc(F)c1)c1ccccn1 |
| InChI | InChI=1S/C22H20FNO2/c23-19-12-7-11-18(16-19)22(20-13-4-5-15-24-20)26-21(25)14-6-10-17-8-2-1-3-9-17/h1-5,7-9,11-13,15-16,22H,6,10,14H2 |
| InChIKey | WJJUWDFQELZXOU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |