About [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate
[(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 60615686) has the molecular formula C23H16ClFN2O2S
and a molecular weight of 438.91 g/mol. Its IUPAC name is [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate |
| PubChem CID | 60615686 |
| Molecular Formula | C23H16ClFN2O2S |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | O=C(Cc1csc(-c2ccccc2Cl)n1)OC(c1cccc(F)c1)c1ccccn1 |
| InChI | InChI=1S/C23H16ClFN2O2S/c24-19-9-2-1-8-18(19)23-27-17(14-30-23)13-21(28)29-22(20-10-3-4-11-26-20)15-6-5-7-16(25)12-15/h1-12,14,22H,13H2 |
| InChIKey | WCHDEXUOWXONOO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate?
The IUPAC name of [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate (CID 60615686) is [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate?
The canonical SMILES for [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate is O=C(Cc1csc(-c2ccccc2Cl)n1)OC(c1cccc(F)c1)c1ccccn1.
What is the InChIKey of [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate?
The InChIKey is WCHDEXUOWXONOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16ClFN2O2S/c24-19-9-2-1-8-18(19)23-27-17(14-30-23)13-21(28)29-22(20-10-3-4-11-26-20)15-6-5-7-16(25)12-15/h1-12,14,22H,13H2.
What are the key properties of [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate?
[(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate has a molecular weight of 438.91 g/mol, XLogP of 5.87, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-fluorophenyl)-pyridin-2-ylmethyl] 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 60615686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).