C21H17F2NO2 — CID 56528264
[(3-fluorophenyl)-pyridin-2-ylmethyl] 3-(4-fluorophenyl)propanoate (PubChem CID 56528264) has the molecular formula C21H17F2NO2 and a molecular weight of 353.37 g/mol. Its IUPAC name is [(3-fluorophenyl)-pyridin-2-ylmethyl] 3-(4-fluorophenyl)propanoate.
| Compound Name | [(3-fluorophenyl)-pyridin-2-ylmethyl] 3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 56528264 |
| Molecular Formula | C21H17F2NO2 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [(3-fluorophenyl)-pyridin-2-ylmethyl] 3-(4-fluorophenyl)propanoate |
| SMILES | O=C(CCc1ccc(F)cc1)OC(c1cccc(F)c1)c1ccccn1 |
| InChI | InChI=1S/C21H17F2NO2/c22-17-10-7-15(8-11-17)9-12-20(25)26-21(19-6-1-2-13-24-19)16-4-3-5-18(23)14-16/h1-8,10-11,13-14,21H,9,12H2 |
| InChIKey | LNBZMXVAPXMOPX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |