C23H20F2N2O2 — CID 52524823
4-(4-fluorophenyl)-N-[(S)-(3-fluorophenyl)-pyridin-2-ylmethyl]-N-methyl-4-oxobutanamide (PubChem CID 52524823) has the molecular formula C23H20F2N2O2 and a molecular weight of 394.42 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[(S)-(3-fluorophenyl)-pyridin-2-ylmethyl]-N-methyl-4-oxobutanamide.
| Compound Name | 4-(4-fluorophenyl)-N-[(S)-(3-fluorophenyl)-pyridin-2-ylmethyl]-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 52524823 |
| Molecular Formula | C23H20F2N2O2 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[(S)-(3-fluorophenyl)-pyridin-2-ylmethyl]-N-methyl-4-oxobutanamide |
| SMILES | CN(C(=O)CCC(=O)c1ccc(F)cc1)[C@@H](c1cccc(F)c1)c1ccccn1 |
| InChI | InChI=1S/C23H20F2N2O2/c1-27(22(29)13-12-21(28)16-8-10-18(24)11-9-16)23(20-7-2-3-14-26-20)17-5-4-6-19(25)15-17/h2-11,14-15,23H,12-13H2,1H3/t23-/m0/s1 |
| InChIKey | ZBZCLYBNCBVMIG-QHCPKHFHSA-N |
| XLogP | 4.57 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |