C18H16ClNO — CID 11808640
2-(3-chlorophenyl)-3-oxo-6-phenylhexanenitrile (PubChem CID 11808640) has the molecular formula C18H16ClNO and a molecular weight of 297.79 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-oxo-6-phenylhexanenitrile.
| Compound Name | 2-(3-chlorophenyl)-3-oxo-6-phenylhexanenitrile |
|---|---|
| PubChem CID | 11808640 |
| Molecular Formula | C18H16ClNO |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-(3-chlorophenyl)-3-oxo-6-phenylhexanenitrile |
| SMILES | N#CC(C(=O)CCCc1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16ClNO/c19-16-10-5-9-15(12-16)17(13-20)18(21)11-4-8-14-6-2-1-3-7-14/h1-3,5-7,9-10,12,17H,4,8,11H2 |
| InChIKey | JDIFBDHSMZPYOH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |