C15H19FN2O — CID 112516955
4-cyano-N,N-diethyl-4-(4-fluorophenyl)butanamide (PubChem CID 112516955) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is 4-cyano-N,N-diethyl-4-(4-fluorophenyl)butanamide.
| Compound Name | 4-cyano-N,N-diethyl-4-(4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 112516955 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-cyano-N,N-diethyl-4-(4-fluorophenyl)butanamide |
| SMILES | CCN(CC)C(=O)CCC(C#N)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O/c1-3-18(4-2)15(19)10-7-13(11-17)12-5-8-14(16)9-6-12/h5-6,8-9,13H,3-4,7,10H2,1-2H3 |
| InChIKey | UAXCTOZITDYJQN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |