C15H16FN3OS — CID 95330227
N,N-bis(cyanomethyl)-3-[(1S)-1-(4-fluorophenyl)ethyl]sulfanylpropanamide (PubChem CID 95330227) has the molecular formula C15H16FN3OS and a molecular weight of 305.38 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-3-[(1S)-1-(4-fluorophenyl)ethyl]sulfanylpropanamide.
| Compound Name | N,N-bis(cyanomethyl)-3-[(1S)-1-(4-fluorophenyl)ethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 95330227 |
| Molecular Formula | C15H16FN3OS |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N,N-bis(cyanomethyl)-3-[(1S)-1-(4-fluorophenyl)ethyl]sulfanylpropanamide |
| SMILES | C[C@H](SCCC(=O)N(CC#N)CC#N)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H16FN3OS/c1-12(13-2-4-14(16)5-3-13)21-11-6-15(20)19(9-7-17)10-8-18/h2-5,12H,6,9-11H2,1H3/t12-/m0/s1 |
| InChIKey | QPMDCQARTBXRBO-LBPRGKRZSA-N |
| XLogP | 2.89 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|