C13H15FN2OS — CID 51078766
2-(cyanomethylsulfanyl)-N-[1-(4-fluorophenyl)ethyl]-N-methylacetamide (PubChem CID 51078766) has the molecular formula C13H15FN2OS and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-[1-(4-fluorophenyl)ethyl]-N-methylacetamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-[1-(4-fluorophenyl)ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 51078766 |
| Molecular Formula | C13H15FN2OS |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-[1-(4-fluorophenyl)ethyl]-N-methylacetamide |
| SMILES | CC(c1ccc(F)cc1)N(C)C(=O)CSCC#N |
| InChI | InChI=1S/C13H15FN2OS/c1-10(11-3-5-12(14)6-4-11)16(2)13(17)9-18-8-7-15/h3-6,10H,8-9H2,1-2H3 |
| InChIKey | NLCJUKPOQSFNNP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|