C13H16FNO3S — CID 113219837
2-[2-[1-(4-fluorophenyl)ethyl-methylamino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 113219837) has the molecular formula C13H16FNO3S and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[2-[1-(4-fluorophenyl)ethyl-methylamino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[1-(4-fluorophenyl)ethyl-methylamino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 113219837 |
| Molecular Formula | C13H16FNO3S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-[2-[1-(4-fluorophenyl)ethyl-methylamino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | CC(c1ccc(F)cc1)N(C)C(=O)CSCC(=O)O |
| InChI | InChI=1S/C13H16FNO3S/c1-9(10-3-5-11(14)6-4-10)15(2)12(16)7-19-8-13(17)18/h3-6,9H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | CNVLODAWJRFJCU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |