C11H15FO2S — CID 97221129
(2R)-3-[(1R)-1-(4-fluorophenyl)ethyl]sulfanylpropane-1,2-diol (PubChem CID 97221129) has the molecular formula C11H15FO2S and a molecular weight of 230.30 g/mol. Its IUPAC name is (2R)-3-[(1R)-1-(4-fluorophenyl)ethyl]sulfanylpropane-1,2-diol.
| Compound Name | (2R)-3-[(1R)-1-(4-fluorophenyl)ethyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 97221129 |
| Molecular Formula | C11H15FO2S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (2R)-3-[(1R)-1-(4-fluorophenyl)ethyl]sulfanylpropane-1,2-diol |
| SMILES | C[C@@H](SC[C@H](O)CO)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FO2S/c1-8(15-7-11(14)6-13)9-2-4-10(12)5-3-9/h2-5,8,11,13-14H,6-7H2,1H3/t8-,11-/m1/s1 |
| InChIKey | PAOIBELQDXFZSA-LDYMZIIASA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |