C12H18ClNO2S — CID 79682481
3-[2-amino-1-(4-chlorophenyl)propyl]sulfanylpropane-1,2-diol (PubChem CID 79682481) has the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. Its IUPAC name is 3-[2-amino-1-(4-chlorophenyl)propyl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[2-amino-1-(4-chlorophenyl)propyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 79682481 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-[2-amino-1-(4-chlorophenyl)propyl]sulfanylpropane-1,2-diol |
| SMILES | CC(N)C(SCC(O)CO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClNO2S/c1-8(14)12(17-7-11(16)6-15)9-2-4-10(13)5-3-9/h2-5,8,11-12,15-16H,6-7,14H2,1H3 |
| InChIKey | QMTUTDLLKFDCHG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |