C11H15ClO2S — CID 97221112
(2S)-3-[(1S)-1-(2-chlorophenyl)ethyl]sulfanylpropane-1,2-diol (PubChem CID 97221112) has the molecular formula C11H15ClO2S and a molecular weight of 246.76 g/mol. Its IUPAC name is (2S)-3-[(1S)-1-(2-chlorophenyl)ethyl]sulfanylpropane-1,2-diol.
| Compound Name | (2S)-3-[(1S)-1-(2-chlorophenyl)ethyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 97221112 |
| Molecular Formula | C11H15ClO2S |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (2S)-3-[(1S)-1-(2-chlorophenyl)ethyl]sulfanylpropane-1,2-diol |
| SMILES | C[C@H](SC[C@@H](O)CO)c1ccccc1Cl |
| InChI | InChI=1S/C11H15ClO2S/c1-8(15-7-9(14)6-13)10-4-2-3-5-11(10)12/h2-5,8-9,13-14H,6-7H2,1H3/t8-,9-/m0/s1 |
| InChIKey | CBFZXGWCUUALQN-IUCAKERBSA-N |
| XLogP | 2.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |