C11H16O2S — CID 79682648
3-(1-phenylethylsulfanyl)propane-1,2-diol (PubChem CID 79682648) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 3-(1-phenylethylsulfanyl)propane-1,2-diol.
| Compound Name | 3-(1-phenylethylsulfanyl)propane-1,2-diol |
|---|---|
| PubChem CID | 79682648 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 3-(1-phenylethylsulfanyl)propane-1,2-diol |
| SMILES | CC(SCC(O)CO)c1ccccc1 |
| InChI | InChI=1S/C11H16O2S/c1-9(14-8-11(13)7-12)10-5-3-2-4-6-10/h2-6,9,11-13H,7-8H2,1H3 |
| InChIKey | MBRXMMDEWNCVIJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |