C29H44O2S — CID 146600373
3-(5,6,6,8-tetramethyl-4,8-diphenyldecan-2-yl)sulfanylpropane-1,2-diol (PubChem CID 146600373) has the molecular formula C29H44O2S and a molecular weight of 456.74 g/mol. Its IUPAC name is 3-(5,6,6,8-tetramethyl-4,8-diphenyldecan-2-yl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(5,6,6,8-tetramethyl-4,8-diphenyldecan-2-yl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 146600373 |
| Molecular Formula | C29H44O2S |
| Molecular Weight | 456.74 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | 3-(5,6,6,8-tetramethyl-4,8-diphenyldecan-2-yl)sulfanylpropane-1,2-diol |
| SMILES | CCC(C)(CC(C)(C)C(C)C(CC(C)SCC(O)CO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H44O2S/c1-7-29(6,25-16-12-9-13-17-25)21-28(4,5)23(3)27(24-14-10-8-11-15-24)18-22(2)32-20-26(31)19-30/h8-17,22-23,26-27,30-31H,7,18-21H2,1-6H3 |
| InChIKey | GYKGEUWULBVLGE-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.74 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |