C19H15F3O2 — CID 162539732
(3S)-1-(4-methoxyphenyl)-5-phenyl-3-(trifluoromethyl)pent-4-yn-1-one (PubChem CID 162539732) has the molecular formula C19H15F3O2 and a molecular weight of 332.32 g/mol. Its IUPAC name is (3S)-1-(4-methoxyphenyl)-5-phenyl-3-(trifluoromethyl)pent-4-yn-1-one.
| Compound Name | (3S)-1-(4-methoxyphenyl)-5-phenyl-3-(trifluoromethyl)pent-4-yn-1-one |
|---|---|
| PubChem CID | 162539732 |
| Molecular Formula | C19H15F3O2 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (3S)-1-(4-methoxyphenyl)-5-phenyl-3-(trifluoromethyl)pent-4-yn-1-one |
| SMILES | COc1ccc(C(=O)C[C@@H](C#Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3O2/c1-24-17-11-8-15(9-12-17)18(23)13-16(19(20,21)22)10-7-14-5-3-2-4-6-14/h2-6,8-9,11-12,16H,13H2,1H3/t16-/m1/s1 |
| InChIKey | QFRISLVHLOCFRK-MRXNPFEDSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|