C29H28O4 — CID 3124431
1,5-bis(4-methoxyphenyl)-2,4-dimethyl-3-(2-phenylethynyl)pentane-1,5-dione (PubChem CID 3124431) has the molecular formula C29H28O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1,5-bis(4-methoxyphenyl)-2,4-dimethyl-3-(2-phenylethynyl)pentane-1,5-dione.
| Compound Name | 1,5-bis(4-methoxyphenyl)-2,4-dimethyl-3-(2-phenylethynyl)pentane-1,5-dione |
|---|---|
| PubChem CID | 3124431 |
| Molecular Formula | C29H28O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 1,5-bis(4-methoxyphenyl)-2,4-dimethyl-3-(2-phenylethynyl)pentane-1,5-dione |
| SMILES | COc1ccc(C(=O)C(C)C(C#Cc2ccccc2)C(C)C(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H28O4/c1-20(28(30)23-11-15-25(32-3)16-12-23)27(19-10-22-8-6-5-7-9-22)21(2)29(31)24-13-17-26(33-4)18-14-24/h5-9,11-18,20-21,27H,1-4H3 |
| InChIKey | HILOGFVLUZLEML-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|