C32H27NO2S — CID 132512480
3-(4-methoxyphenyl)-2-(4-methylbenzoyl)-N,5-diphenylpent-4-ynethioamide (PubChem CID 132512480) has the molecular formula C32H27NO2S and a molecular weight of 489.64 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-(4-methylbenzoyl)-N,5-diphenylpent-4-ynethioamide.
| Compound Name | 3-(4-methoxyphenyl)-2-(4-methylbenzoyl)-N,5-diphenylpent-4-ynethioamide |
|---|---|
| PubChem CID | 132512480 |
| Molecular Formula | C32H27NO2S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-(4-methylbenzoyl)-N,5-diphenylpent-4-ynethioamide |
| SMILES | COc1ccc(C(C#Cc2ccccc2)C(C(=O)c2ccc(C)cc2)C(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C32H27NO2S/c1-23-13-16-26(17-14-23)31(34)30(32(36)33-27-11-7-4-8-12-27)29(22-15-24-9-5-3-6-10-24)25-18-20-28(35-2)21-19-25/h3-14,16-21,29-30H,1-2H3,(H,33,36) |
| InChIKey | YKERCAYDJNAKPQ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|