C25H31NO3 — CID 118184135
ethyl (E,5R)-5-(dibenzylamino)-2,6-dimethyl-4-oxohept-2-enoate (PubChem CID 118184135) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is ethyl (E,5R)-5-(dibenzylamino)-2,6-dimethyl-4-oxohept-2-enoate.
| Compound Name | ethyl (E,5R)-5-(dibenzylamino)-2,6-dimethyl-4-oxohept-2-enoate |
|---|---|
| PubChem CID | 118184135 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | ethyl (E,5R)-5-(dibenzylamino)-2,6-dimethyl-4-oxohept-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/C(=O)[C@@H](C(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H31NO3/c1-5-29-25(28)20(4)16-23(27)24(19(2)3)26(17-21-12-8-6-9-13-21)18-22-14-10-7-11-15-22/h6-16,19,24H,5,17-18H2,1-4H3/b20-16+/t24-/m1/s1 |
| InChIKey | CUXDAPACQRCPEO-ZOSFRFIDSA-N |
| XLogP | 4.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|