C25H32N2O2 — CID 10763111
ethyl (E)-4-(dibenzylamino)-3-pyrrolidin-1-ylpent-2-enoate (PubChem CID 10763111) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is ethyl (E)-4-(dibenzylamino)-3-pyrrolidin-1-ylpent-2-enoate.
| Compound Name | ethyl (E)-4-(dibenzylamino)-3-pyrrolidin-1-ylpent-2-enoate |
|---|---|
| PubChem CID | 10763111 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | ethyl (E)-4-(dibenzylamino)-3-pyrrolidin-1-ylpent-2-enoate |
| SMILES | CCOC(=O)/C=C(\C(C)N(Cc1ccccc1)Cc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C25H32N2O2/c1-3-29-25(28)18-24(26-16-10-11-17-26)21(2)27(19-22-12-6-4-7-13-22)20-23-14-8-5-9-15-23/h4-9,12-15,18,21H,3,10-11,16-17,19-20H2,1-2H3/b24-18+ |
| InChIKey | DQRKWDOCBZJOHZ-HKOYGPOVSA-N |
| XLogP | 4.62 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|