About 1-iodoprop-2-enylbenzene
1-iodoprop-2-enylbenzene (PubChem CID 21195039) has the molecular formula C9H9I
and a molecular weight of 244.08 g/mol. Its IUPAC name is 1-iodoprop-2-enylbenzene.
Molecular Properties
| Compound Name | 1-iodoprop-2-enylbenzene |
| PubChem CID | 21195039 |
| Molecular Formula | C9H9I |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | 1-iodoprop-2-enylbenzene |
| SMILES | C=CC(I)c1ccccc1 |
| InChI | InChI=1S/C9H9I/c1-2-9(10)8-6-4-3-5-7-8/h2-7,9H,1H2 |
| InChIKey | YAUZKNDNVSEDKE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-iodoprop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodoprop-2-enylbenzene?
The IUPAC name of 1-iodoprop-2-enylbenzene (CID 21195039) is 1-iodoprop-2-enylbenzene.
What is the SMILES notation for 1-iodoprop-2-enylbenzene?
The canonical SMILES for 1-iodoprop-2-enylbenzene is C=CC(I)c1ccccc1.
What is the InChIKey of 1-iodoprop-2-enylbenzene?
The InChIKey is YAUZKNDNVSEDKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9I/c1-2-9(10)8-6-4-3-5-7-8/h2-7,9H,1H2.
What are the key properties of 1-iodoprop-2-enylbenzene?
1-iodoprop-2-enylbenzene has a molecular weight of 244.08 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodoprop-2-enylbenzene is sourced from PubChem (CID 21195039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).