About [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate
[4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate (PubChem CID 67678043) has the molecular formula C21H19O5P
and a molecular weight of 382.35 g/mol. Its IUPAC name is [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate.
Molecular Properties
| Compound Name | [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate |
| PubChem CID | 67678043 |
| Molecular Formula | C21H19O5P |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate |
| SMILES | C=CC(O)c1ccc(OP(=O)(Oc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H19O5P/c1-2-21(22)17-13-15-20(16-14-17)26-27(23,24-18-9-5-3-6-10-18)25-19-11-7-4-8-12-19/h2-16,21-22H,1H2 |
| InChIKey | GZRBBBJBELVWOS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate?
The IUPAC name of [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate (CID 67678043) is [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate.
What is the SMILES notation for [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate?
The canonical SMILES for [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate is C=CC(O)c1ccc(OP(=O)(Oc2ccccc2)Oc2ccccc2)cc1.
What is the InChIKey of [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate?
The InChIKey is GZRBBBJBELVWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19O5P/c1-2-21(22)17-13-15-20(16-14-17)26-27(23,24-18-9-5-3-6-10-18)25-19-11-7-4-8-12-19/h2-16,21-22H,1H2.
What are the key properties of [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate?
[4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate has a molecular weight of 382.35 g/mol, XLogP of 5.55, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-hydroxyprop-2-enyl)phenyl] diphenyl phosphate is sourced from PubChem (CID 67678043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).