C16H16O2 — CID 102148405
2-[(1S,2S)-1-hydroxy-1-phenylbut-3-en-2-yl]phenol (PubChem CID 102148405) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-[(1S,2S)-1-hydroxy-1-phenylbut-3-en-2-yl]phenol.
| Compound Name | 2-[(1S,2S)-1-hydroxy-1-phenylbut-3-en-2-yl]phenol |
|---|---|
| PubChem CID | 102148405 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-[(1S,2S)-1-hydroxy-1-phenylbut-3-en-2-yl]phenol |
| SMILES | C=C[C@@H](c1ccccc1O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H16O2/c1-2-13(14-10-6-7-11-15(14)17)16(18)12-8-4-3-5-9-12/h2-11,13,16-18H,1H2/t13-,16+/m0/s1 |
| InChIKey | LALYIGWGBPCZBJ-XJKSGUPXSA-N |
| XLogP | 3.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|