C20H27NO3 — CID 102206695
2-[2-[(1R,2S)-2-(benzylamino)-1-phenylpropoxy]ethoxy]ethanol (PubChem CID 102206695) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-[2-[(1R,2S)-2-(benzylamino)-1-phenylpropoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[(1R,2S)-2-(benzylamino)-1-phenylpropoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 102206695 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-[2-[(1R,2S)-2-(benzylamino)-1-phenylpropoxy]ethoxy]ethanol |
| SMILES | C[C@H](NCc1ccccc1)[C@H](OCCOCCO)c1ccccc1 |
| InChI | InChI=1S/C20H27NO3/c1-17(21-16-18-8-4-2-5-9-18)20(19-10-6-3-7-11-19)24-15-14-23-13-12-22/h2-11,17,20-22H,12-16H2,1H3/t17-,20-/m0/s1 |
| InChIKey | DQJJENVUDVGHMB-PXNSSMCTSA-N |
| XLogP | 2.93 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|