C11H12F3IO — CID 114774573
[2-iodo-1-(1,1,1-trifluoropropan-2-yloxy)ethyl]benzene (PubChem CID 114774573) has the molecular formula C11H12F3IO and a molecular weight of 344.11 g/mol. Its IUPAC name is [2-iodo-1-(1,1,1-trifluoropropan-2-yloxy)ethyl]benzene.
| Compound Name | [2-iodo-1-(1,1,1-trifluoropropan-2-yloxy)ethyl]benzene |
|---|---|
| PubChem CID | 114774573 |
| Molecular Formula | C11H12F3IO |
| Molecular Weight | 344.11 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | [2-iodo-1-(1,1,1-trifluoropropan-2-yloxy)ethyl]benzene |
| SMILES | CC(OC(CI)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H12F3IO/c1-8(11(12,13)14)16-10(7-15)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3 |
| InChIKey | SKVCQVFZZPXZOS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.11 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|