C29H45N3O3 — CID 172920699
formonitrile;4-heptoxy-N'-hydroxybenzenecarboximidamide;1-heptoxy-4-methylbenzene (PubChem CID 172920699) has the molecular formula C29H45N3O3 and a molecular weight of 483.70 g/mol. Its IUPAC name is formonitrile;4-heptoxy-N'-hydroxybenzenecarboximidamide;1-heptoxy-4-methylbenzene.
| Compound Name | formonitrile;4-heptoxy-N'-hydroxybenzenecarboximidamide;1-heptoxy-4-methylbenzene |
|---|---|
| PubChem CID | 172920699 |
| Molecular Formula | C29H45N3O3 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | formonitrile;4-heptoxy-N'-hydroxybenzenecarboximidamide;1-heptoxy-4-methylbenzene |
| SMILES | C#N.CCCCCCCOc1ccc(/C(N)=N/O)cc1.CCCCCCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C14H22N2O2.C14H22O.CHN/c1-2-3-4-5-6-11-18-13-9-7-12(8-10-13)14(15)16-17;1-3-4-5-6-7-12-15-14-10-8-13(2)9-11-14;1-2/h7-10,17H,2-6,11H2,1H3,(H2,15,16);8-11H,3-7,12H2,1-2H3;1H |
| InChIKey | SAFJSWVHMBJQPR-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|