About 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate
2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate (PubChem CID 162678930) has the molecular formula C15H12N2O4-2
and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate.
Molecular Properties
| Compound Name | 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate |
| PubChem CID | 162678930 |
| Molecular Formula | C15H12N2O4-2 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate |
| SMILES | O=C([O-])C(=O)[O-].c1ccc2cc(C3=NCCN3)ccc2c1 |
| InChI | InChI=1S/C13H12N2.C2H2O4/c1-2-4-11-9-12(6-5-10(11)3-1)13-14-7-8-15-13;3-1(4)2(5)6/h1-6,9H,7-8H2,(H,14,15);(H,3,4)(H,5,6)/p-2 |
| InChIKey | LSGXLXVKKUXDTD-UHFFFAOYSA-L |
| XLogP | -1.32 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate?
The IUPAC name of 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate (CID 162678930) is 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate.
What is the SMILES notation for 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate?
The canonical SMILES for 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate is O=C([O-])C(=O)[O-].c1ccc2cc(C3=NCCN3)ccc2c1.
What is the InChIKey of 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate?
The InChIKey is LSGXLXVKKUXDTD-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H12N2.C2H2O4/c1-2-4-11-9-12(6-5-10(11)3-1)13-14-7-8-15-13;3-1(4)2(5)6/h1-6,9H,7-8H2,(H,14,15);(H,3,4)(H,5,6)/p-2.
What are the key properties of 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate?
2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate has a molecular weight of 284.27 g/mol, XLogP of -1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole;oxalate is sourced from PubChem (CID 162678930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).