C11H14N2S — CID 126982323
2-(4-ethylsulfanylphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 126982323) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-(4-ethylsulfanylphenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | 2-(4-ethylsulfanylphenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 126982323 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-(4-ethylsulfanylphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | CCSc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C11H14N2S/c1-2-14-10-5-3-9(4-6-10)11-12-7-8-13-11/h3-6H,2,7-8H2,1H3,(H,12,13) |
| InChIKey | IMLLTWZBSPJPNY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |