C29H41ClN8O2 — CID 54609528
1-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]-3-[7-[[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]carbamoylamino]heptyl]urea;hydrochloride (PubChem CID 54609528) has the molecular formula C29H41ClN8O2 and a molecular weight of 569.15 g/mol. Its IUPAC name is 1-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]-3-[7-[[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]carbamoylamino]heptyl]urea;hydrochloride.
| Compound Name | 1-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]-3-[7-[[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]carbamoylamino]heptyl]urea;hydrochloride |
|---|---|
| PubChem CID | 54609528 |
| Molecular Formula | C29H41ClN8O2 |
| Molecular Weight | 569.15 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 1-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]-3-[7-[[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]carbamoylamino]heptyl]urea;hydrochloride |
| SMILES | Cl.O=C(NCCCCCCCNC(=O)Nc1ccc(C2=NCCCN2)cc1)Nc1ccc(C2=NCCCN2)cc1 |
| InChI | InChI=1S/C29H40N8O2.ClH/c38-28(36-24-12-8-22(9-13-24)26-30-18-6-19-31-26)34-16-4-2-1-3-5-17-35-29(39)37-25-14-10-23(11-15-25)27-32-20-7-21-33-27;/h8-15H,1-7,16-21H2,(H,30,31)(H,32,33)(H2,34,36,38)(H2,35,37,39);1H |
| InChIKey | YJSRXWCTMNOSMO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.15 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|