C27H30BN2O2 — CID 58756744
CID 58756744 (PubChem CID 58756744) has the molecular formula C27H30BN2O2 and a molecular weight of 425.36 g/mol.
| Compound Name | CID 58756744 |
|---|---|
| PubChem CID | 58756744 |
| Molecular Formula | C27H30BN2O2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | — |
| SMILES | O=C(C[B]Cc1ccccc1)NCCCCCC(=O)Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H30BN2O2/c31-26(30-25-16-10-15-24(19-25)23-13-6-2-7-14-23)17-8-3-9-18-29-27(32)21-28-20-22-11-4-1-5-12-22/h1-2,4-7,10-16,19H,3,8-9,17-18,20-21H2,(H,29,32)(H,30,31) |
| InChIKey | FLWMSKLCLFYKSC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|