C28H32N2O4 — CID 11952976
6-[[2-[[4-(hydroxymethyl)phenyl]methoxy]acetyl]amino]-N-(3-phenylphenyl)hexanamide (PubChem CID 11952976) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 6-[[2-[[4-(hydroxymethyl)phenyl]methoxy]acetyl]amino]-N-(3-phenylphenyl)hexanamide.
| Compound Name | 6-[[2-[[4-(hydroxymethyl)phenyl]methoxy]acetyl]amino]-N-(3-phenylphenyl)hexanamide |
|---|---|
| PubChem CID | 11952976 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 6-[[2-[[4-(hydroxymethyl)phenyl]methoxy]acetyl]amino]-N-(3-phenylphenyl)hexanamide |
| SMILES | O=C(COCc1ccc(CO)cc1)NCCCCCC(=O)Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H32N2O4/c31-19-22-13-15-23(16-14-22)20-34-21-28(33)29-17-6-2-5-12-27(32)30-26-11-7-10-25(18-26)24-8-3-1-4-9-24/h1,3-4,7-11,13-16,18,31H,2,5-6,12,17,19-21H2,(H,29,33)(H,30,32) |
| InChIKey | LTXJASGMLVETNB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|