C25H28N2O4 — CID 11953017
6-[[2-(furan-3-ylmethoxy)acetyl]amino]-N-(3-phenylphenyl)hexanamide (PubChem CID 11953017) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 6-[[2-(furan-3-ylmethoxy)acetyl]amino]-N-(3-phenylphenyl)hexanamide.
| Compound Name | 6-[[2-(furan-3-ylmethoxy)acetyl]amino]-N-(3-phenylphenyl)hexanamide |
|---|---|
| PubChem CID | 11953017 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 6-[[2-(furan-3-ylmethoxy)acetyl]amino]-N-(3-phenylphenyl)hexanamide |
| SMILES | O=C(COCc1ccoc1)NCCCCCC(=O)Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H28N2O4/c28-24(27-23-11-7-10-22(16-23)21-8-3-1-4-9-21)12-5-2-6-14-26-25(29)19-31-18-20-13-15-30-17-20/h1,3-4,7-11,13,15-17H,2,5-6,12,14,18-19H2,(H,26,29)(H,27,28) |
| InChIKey | YXLORVSAISHPGZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|