C17H21F3N2O3 — CID 70145027
3-methyl-2-oxo-N-[4-(trifluoromethyl)phenyl]nonanediamide (PubChem CID 70145027) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 3-methyl-2-oxo-N-[4-(trifluoromethyl)phenyl]nonanediamide.
| Compound Name | 3-methyl-2-oxo-N-[4-(trifluoromethyl)phenyl]nonanediamide |
|---|---|
| PubChem CID | 70145027 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-methyl-2-oxo-N-[4-(trifluoromethyl)phenyl]nonanediamide |
| SMILES | CC(CCCCCC(N)=O)C(=O)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H21F3N2O3/c1-11(5-3-2-4-6-14(21)23)15(24)16(25)22-13-9-7-12(8-10-13)17(18,19)20/h7-11H,2-6H2,1H3,(H2,21,23)(H,22,25) |
| InChIKey | YYUIYCSCAJGEEQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|