C18H20ClNO4 — CID 71801512
2-(4-chlorophenoxy)-N-(furan-2-ylmethyl)-N-(oxan-4-yl)acetamide (PubChem CID 71801512) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(furan-2-ylmethyl)-N-(oxan-4-yl)acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-(furan-2-ylmethyl)-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 71801512 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(furan-2-ylmethyl)-N-(oxan-4-yl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)N(Cc1ccco1)C1CCOCC1 |
| InChI | InChI=1S/C18H20ClNO4/c19-14-3-5-16(6-4-14)24-13-18(21)20(12-17-2-1-9-23-17)15-7-10-22-11-8-15/h1-6,9,15H,7-8,10-13H2 |
| InChIKey | CKGDSRBJXFTBFP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |