C28H31ClN2O4 — CID 5226008
N-benzyl-2-[[2-(4-chlorophenoxy)acetyl]-cyclohexylamino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 5226008) has the molecular formula C28H31ClN2O4 and a molecular weight of 495.02 g/mol. Its IUPAC name is N-benzyl-2-[[2-(4-chlorophenoxy)acetyl]-cyclohexylamino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[[2-(4-chlorophenoxy)acetyl]-cyclohexylamino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 5226008 |
| Molecular Formula | C28H31ClN2O4 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-benzyl-2-[[2-(4-chlorophenoxy)acetyl]-cyclohexylamino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CN(C(=O)COc1ccc(Cl)cc1)C1CCCCC1)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C28H31ClN2O4/c29-23-13-15-25(16-14-23)35-21-28(33)31(24-10-5-2-6-11-24)20-27(32)30(19-26-12-7-17-34-26)18-22-8-3-1-4-9-22/h1,3-4,7-9,12-17,24H,2,5-6,10-11,18-21H2 |
| InChIKey | ZVQWLGHZRIGQKD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |