C24H34N2O5 — CID 19004583
[2-acetyloxy-4-[(E)-3-[2-(dimethylamino)ethyl-(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenyl] acetate (PubChem CID 19004583) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is [2-acetyloxy-4-[(E)-3-[2-(dimethylamino)ethyl-(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[(E)-3-[2-(dimethylamino)ethyl-(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 19004583 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | [2-acetyloxy-4-[(E)-3-[2-(dimethylamino)ethyl-(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C/C(=O)N(CCN(C)C)C2CCC(C)CC2)cc1OC(C)=O |
| InChI | InChI=1S/C24H34N2O5/c1-17-6-10-21(11-7-17)26(15-14-25(4)5)24(29)13-9-20-8-12-22(30-18(2)27)23(16-20)31-19(3)28/h8-9,12-13,16-17,21H,6-7,10-11,14-15H2,1-5H3/b13-9+ |
| InChIKey | ZBNBEWFXYVZURZ-UKTHLTGXSA-N |
| XLogP | 3.52 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|