C19H18BrCl2NO3 — CID 58690652
(Z)-3-[4-[bis(2-hydroxyethyl)amino]-3,5-dichlorophenyl]-1-(4-bromophenyl)prop-2-en-1-one (PubChem CID 58690652) has the molecular formula C19H18BrCl2NO3 and a molecular weight of 459.17 g/mol. Its IUPAC name is (Z)-3-[4-[bis(2-hydroxyethyl)amino]-3,5-dichlorophenyl]-1-(4-bromophenyl)prop-2-en-1-one.
| Compound Name | (Z)-3-[4-[bis(2-hydroxyethyl)amino]-3,5-dichlorophenyl]-1-(4-bromophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 58690652 |
| Molecular Formula | C19H18BrCl2NO3 |
| Molecular Weight | 459.17 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | (Z)-3-[4-[bis(2-hydroxyethyl)amino]-3,5-dichlorophenyl]-1-(4-bromophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C\c1cc(Cl)c(N(CCO)CCO)c(Cl)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H18BrCl2NO3/c20-15-4-2-14(3-5-15)18(26)6-1-13-11-16(21)19(17(22)12-13)23(7-9-24)8-10-25/h1-6,11-12,24-25H,7-10H2/b6-1- |
| InChIKey | CBORPWDNNQANJC-BHQIHCQQSA-N |
| XLogP | 4.44 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.17 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|