C41H38FNO6 — CID 45028667
(E)-3-[4-[4-[4-[(E)-3-(2,4-dimethylquinolin-3-yl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]butoxy]-3-methoxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 45028667) has the molecular formula C41H38FNO6 and a molecular weight of 659.75 g/mol. Its IUPAC name is (E)-3-[4-[4-[4-[(E)-3-(2,4-dimethylquinolin-3-yl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]butoxy]-3-methoxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-[4-[4-[(E)-3-(2,4-dimethylquinolin-3-yl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]butoxy]-3-methoxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 45028667 |
| Molecular Formula | C41H38FNO6 |
| Molecular Weight | 659.75 g/mol |
| Exact Mass | 659.27 |
| IUPAC Name | (E)-3-[4-[4-[4-[(E)-3-(2,4-dimethylquinolin-3-yl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]butoxy]-3-methoxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(F)cc2)ccc1OCCCCOc1ccc(/C=C/C(=O)c2c(C)nc3ccccc3c2C)cc1OC |
| InChI | InChI=1S/C41H38FNO6/c1-27-33-9-5-6-10-34(33)43-28(2)41(27)36(45)20-12-30-14-22-38(40(26-30)47-4)49-24-8-7-23-48-37-21-13-29(25-39(37)46-3)11-19-35(44)31-15-17-32(42)18-16-31/h5-6,9-22,25-26H,7-8,23-24H2,1-4H3/b19-11+,20-12+ |
| InChIKey | DFUQQAWWGIQAIA-AYKLPDECSA-N |
| XLogP | 9.04 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.75 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|