C25H25NO5 — CID 56969740
ethyl 2-[4-[(E)-3-(2,4-dimethylquinolin-3-yl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate (PubChem CID 56969740) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-3-(2,4-dimethylquinolin-3-yl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-3-(2,4-dimethylquinolin-3-yl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 56969740 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | ethyl 2-[4-[(E)-3-(2,4-dimethylquinolin-3-yl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C/C(=O)c2c(C)nc3ccccc3c2C)cc1OC |
| InChI | InChI=1S/C25H25NO5/c1-5-30-24(28)15-31-22-13-11-18(14-23(22)29-4)10-12-21(27)25-16(2)19-8-6-7-9-20(19)26-17(25)3/h6-14H,5,15H2,1-4H3/b12-10+ |
| InChIKey | KBNSMIQVTIPVII-ZRDIBKRKSA-N |
| XLogP | 4.70 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|