C33H35N3O5 — CID 45028672
(E)-1-(2,4-dimethylquinolin-3-yl)-3-[4-[3-[4-(furan-2-carbonyl)piperazin-1-yl]propoxy]-3-methoxyphenyl]prop-2-en-1-one (PubChem CID 45028672) has the molecular formula C33H35N3O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is (E)-1-(2,4-dimethylquinolin-3-yl)-3-[4-[3-[4-(furan-2-carbonyl)piperazin-1-yl]propoxy]-3-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dimethylquinolin-3-yl)-3-[4-[3-[4-(furan-2-carbonyl)piperazin-1-yl]propoxy]-3-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 45028672 |
| Molecular Formula | C33H35N3O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | (E)-1-(2,4-dimethylquinolin-3-yl)-3-[4-[3-[4-(furan-2-carbonyl)piperazin-1-yl]propoxy]-3-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2c(C)nc3ccccc3c2C)ccc1OCCCN1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C33H35N3O5/c1-23-26-8-4-5-9-27(26)34-24(2)32(23)28(37)13-11-25-12-14-29(31(22-25)39-3)40-21-7-15-35-16-18-36(19-17-35)33(38)30-10-6-20-41-30/h4-6,8-14,20,22H,7,15-19,21H2,1-3H3/b13-11+ |
| InChIKey | UYYMAVPDWLUQSU-ACCUITESSA-N |
| XLogP | 5.58 |
| TPSA | 85.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|