C49H58N2O6 — CID 71764534
(1E,6E)-4,4-dibenzyl-1,7-bis[3-methoxy-4-(3-pyrrolidin-1-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 71764534) has the molecular formula C49H58N2O6 and a molecular weight of 771.01 g/mol. Its IUPAC name is (1E,6E)-4,4-dibenzyl-1,7-bis[3-methoxy-4-(3-pyrrolidin-1-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-4,4-dibenzyl-1,7-bis[3-methoxy-4-(3-pyrrolidin-1-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 71764534 |
| Molecular Formula | C49H58N2O6 |
| Molecular Weight | 771.01 g/mol |
| Exact Mass | 770.43 |
| IUPAC Name | (1E,6E)-4,4-dibenzyl-1,7-bis[3-methoxy-4-(3-pyrrolidin-1-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)C(Cc2ccccc2)(Cc2ccccc2)C(=O)/C=C/c2ccc(OCCCN3CCCC3)c(OC)c2)ccc1OCCCN1CCCC1 |
| InChI | InChI=1S/C49H58N2O6/c1-54-45-35-39(19-23-43(45)56-33-13-31-50-27-9-10-28-50)21-25-47(52)49(37-41-15-5-3-6-16-41,38-42-17-7-4-8-18-42)48(53)26-22-40-20-24-44(46(36-40)55-2)57-34-14-32-51-29-11-12-30-51/h3-8,15-26,35-36H,9-14,27-34,37-38H2,1-2H3/b25-21+,26-22+ |
| InChIKey | HVGSYWAXNWBJCH-CDTUYSNOSA-N |
| XLogP | 8.77 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.01 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|