C49H62N2O6 — CID 71764533
(1E,6E)-4,4-dibenzyl-1,7-bis[4-[3-(diethylamino)propoxy]-3-methoxyphenyl]hepta-1,6-diene-3,5-dione (PubChem CID 71764533) has the molecular formula C49H62N2O6 and a molecular weight of 775.04 g/mol. Its IUPAC name is (1E,6E)-4,4-dibenzyl-1,7-bis[4-[3-(diethylamino)propoxy]-3-methoxyphenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-4,4-dibenzyl-1,7-bis[4-[3-(diethylamino)propoxy]-3-methoxyphenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 71764533 |
| Molecular Formula | C49H62N2O6 |
| Molecular Weight | 775.04 g/mol |
| Exact Mass | 774.46 |
| IUPAC Name | (1E,6E)-4,4-dibenzyl-1,7-bis[4-[3-(diethylamino)propoxy]-3-methoxyphenyl]hepta-1,6-diene-3,5-dione |
| SMILES | CCN(CC)CCCOc1ccc(/C=C/C(=O)C(Cc2ccccc2)(Cc2ccccc2)C(=O)/C=C/c2ccc(OCCCN(CC)CC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C49H62N2O6/c1-7-50(8-2)31-17-33-56-43-27-23-39(35-45(43)54-5)25-29-47(52)49(37-41-19-13-11-14-20-41,38-42-21-15-12-16-22-42)48(53)30-26-40-24-28-44(46(36-40)55-6)57-34-18-32-51(9-3)10-4/h11-16,19-30,35-36H,7-10,17-18,31-34,37-38H2,1-6H3/b29-25+,30-26+ |
| InChIKey | TYRBTBPDXANQNE-XDHTVYJESA-N |
| XLogP | 9.26 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.04 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|