C29H34Cl2O6 — CID 71763080
(1E,6E)-1,7-bis[4-(3-chloropropoxy)-3-methoxyphenyl]-4,4-dimethylhepta-1,6-diene-3,5-dione (PubChem CID 71763080) has the molecular formula C29H34Cl2O6 and a molecular weight of 549.49 g/mol. Its IUPAC name is (1E,6E)-1,7-bis[4-(3-chloropropoxy)-3-methoxyphenyl]-4,4-dimethylhepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis[4-(3-chloropropoxy)-3-methoxyphenyl]-4,4-dimethylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 71763080 |
| Molecular Formula | C29H34Cl2O6 |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | (1E,6E)-1,7-bis[4-(3-chloropropoxy)-3-methoxyphenyl]-4,4-dimethylhepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)C(C)(C)C(=O)/C=C/c2ccc(OCCCCl)c(OC)c2)ccc1OCCCCl |
| InChI | InChI=1S/C29H34Cl2O6/c1-29(2,27(32)13-9-21-7-11-23(25(19-21)34-3)36-17-5-15-30)28(33)14-10-22-8-12-24(26(20-22)35-4)37-18-6-16-31/h7-14,19-20H,5-6,15-18H2,1-4H3/b13-9+,14-10+ |
| InChIKey | HYJQAXQAUSSCDJ-UTLPMFLDSA-N |
| XLogP | 6.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|