C36H50O4 — CID 123292314
1-[4-(henicosa-3,6,9,12,15,18-hexaenoxymethoxy)-3-methoxyphenyl]-4,4-dimethylpent-1-en-3-one (PubChem CID 123292314) has the molecular formula C36H50O4 and a molecular weight of 546.79 g/mol. Its IUPAC name is 1-[4-(henicosa-3,6,9,12,15,18-hexaenoxymethoxy)-3-methoxyphenyl]-4,4-dimethylpent-1-en-3-one.
| Compound Name | 1-[4-(henicosa-3,6,9,12,15,18-hexaenoxymethoxy)-3-methoxyphenyl]-4,4-dimethylpent-1-en-3-one |
|---|---|
| PubChem CID | 123292314 |
| Molecular Formula | C36H50O4 |
| Molecular Weight | 546.79 g/mol |
| Exact Mass | 546.37 |
| IUPAC Name | 1-[4-(henicosa-3,6,9,12,15,18-hexaenoxymethoxy)-3-methoxyphenyl]-4,4-dimethylpent-1-en-3-one |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCOCOc1ccc(C=CC(=O)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C36H50O4/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-29-39-31-40-33-27-25-32(30-34(33)38-5)26-28-35(37)36(2,3)4/h7-8,10-11,13-14,16-17,19-20,22-23,25-28,30H,6,9,12,15,18,21,24,29,31H2,1-5H3 |
| InChIKey | UMHYFUKILQWOPT-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.79 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|