C35H50N2O6 — CID 71763545
(1E,6E)-1,7-bis[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-4,4-dimethylhepta-1,6-diene-3,5-dione (PubChem CID 71763545) has the molecular formula C35H50N2O6 and a molecular weight of 594.79 g/mol. Its IUPAC name is (1E,6E)-1,7-bis[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-4,4-dimethylhepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-4,4-dimethylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 71763545 |
| Molecular Formula | C35H50N2O6 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.37 |
| IUPAC Name | (1E,6E)-1,7-bis[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-4,4-dimethylhepta-1,6-diene-3,5-dione |
| SMILES | CCN(CC)CCOc1ccc(/C=C/C(=O)C(C)(C)C(=O)/C=C/c2ccc(OCCN(CC)CC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C35H50N2O6/c1-9-36(10-2)21-23-42-29-17-13-27(25-31(29)40-7)15-19-33(38)35(5,6)34(39)20-16-28-14-18-30(32(26-28)41-8)43-24-22-37(11-3)12-4/h13-20,25-26H,9-12,21-24H2,1-8H3/b19-15+,20-16+ |
| InChIKey | IEYSEGFXNDJAAB-MXWIWYRXSA-N |
| XLogP | 6.04 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|