C18H16O6 — CID 90113470
(E)-3-[4-(4-hydroxybenzoyl)oxy-3-methoxyphenyl]-2-methylprop-2-enoic acid (PubChem CID 90113470) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is (E)-3-[4-(4-hydroxybenzoyl)oxy-3-methoxyphenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-(4-hydroxybenzoyl)oxy-3-methoxyphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 90113470 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (E)-3-[4-(4-hydroxybenzoyl)oxy-3-methoxyphenyl]-2-methylprop-2-enoic acid |
| SMILES | COc1cc(/C=C(\C)C(=O)O)ccc1OC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H16O6/c1-11(17(20)21)9-12-3-8-15(16(10-12)23-2)24-18(22)13-4-6-14(19)7-5-13/h3-10,19H,1-2H3,(H,20,21)/b11-9+ |
| InChIKey | IFWPCGDZWWYTPV-PKNBQFBNSA-N |
| XLogP | 3.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|